C12H20IN3 — CID 111023150
2-butyl-1-(3-methylphenyl)guanidine;hydroiodide (PubChem CID 111023150) has the molecular formula C12H20IN3 and a molecular weight of 333.22 g/mol. Its IUPAC name is 2-butyl-1-(3-methylphenyl)guanidine;hydroiodide.
| Compound Name | 2-butyl-1-(3-methylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111023150 |
| Molecular Formula | C12H20IN3 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 2-butyl-1-(3-methylphenyl)guanidine;hydroiodide |
| SMILES | CCCC/N=C(\N)Nc1cccc(C)c1.I |
| InChI | InChI=1S/C12H19N3.HI/c1-3-4-8-14-12(13)15-11-7-5-6-10(2)9-11;/h5-7,9H,3-4,8H2,1-2H3,(H3,13,14,15);1H |
| InChIKey | KFQSYLGQKJXBFH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|