C15H27IN4 — CID 111802291
2-[2-[butyl(methyl)amino]ethyl]-1-(3-methylphenyl)guanidine;hydroiodide (PubChem CID 111802291) has the molecular formula C15H27IN4 and a molecular weight of 390.31 g/mol. Its IUPAC name is 2-[2-[butyl(methyl)amino]ethyl]-1-(3-methylphenyl)guanidine;hydroiodide.
| Compound Name | 2-[2-[butyl(methyl)amino]ethyl]-1-(3-methylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111802291 |
| Molecular Formula | C15H27IN4 |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2-[2-[butyl(methyl)amino]ethyl]-1-(3-methylphenyl)guanidine;hydroiodide |
| SMILES | CCCCN(C)CC/N=C(\N)Nc1cccc(C)c1.I |
| InChI | InChI=1S/C15H26N4.HI/c1-4-5-10-19(3)11-9-17-15(16)18-14-8-6-7-13(2)12-14;/h6-8,12H,4-5,9-11H2,1-3H3,(H3,16,17,18);1H |
| InChIKey | QUJTXOCXVUFOPJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|