C14H24N4 — CID 111085735
1-(3,5-dimethylphenyl)-2-[2-[ethyl(methyl)amino]ethyl]guanidine (PubChem CID 111085735) has the molecular formula C14H24N4 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-[2-[ethyl(methyl)amino]ethyl]guanidine.
| Compound Name | 1-(3,5-dimethylphenyl)-2-[2-[ethyl(methyl)amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111085735 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-[2-[ethyl(methyl)amino]ethyl]guanidine |
| SMILES | CCN(C)CC/N=C(\N)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C14H24N4/c1-5-18(4)7-6-16-14(15)17-13-9-11(2)8-12(3)10-13/h8-10H,5-7H2,1-4H3,(H3,15,16,17) |
| InChIKey | QYKDXGNRTMLBPK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|