C13H21N3O2S — CID 111067162
1-(3,5-dimethylphenyl)-2-(3-methylsulfonylpropyl)guanidine (PubChem CID 111067162) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-(3-methylsulfonylpropyl)guanidine.
| Compound Name | 1-(3,5-dimethylphenyl)-2-(3-methylsulfonylpropyl)guanidine |
|---|---|
| PubChem CID | 111067162 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-(3-methylsulfonylpropyl)guanidine |
| SMILES | Cc1cc(C)cc(N/C(N)=N/CCCS(C)(=O)=O)c1 |
| InChI | InChI=1S/C13H21N3O2S/c1-10-7-11(2)9-12(8-10)16-13(14)15-5-4-6-19(3,17)18/h7-9H,4-6H2,1-3H3,(H3,14,15,16) |
| InChIKey | WDEWBKPRULYOAU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|