C14H24N4O2S — CID 119120935
1-(3,5-dimethylphenyl)-2-[2-(propan-2-ylsulfamoyl)ethyl]guanidine (PubChem CID 119120935) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-[2-(propan-2-ylsulfamoyl)ethyl]guanidine.
| Compound Name | 1-(3,5-dimethylphenyl)-2-[2-(propan-2-ylsulfamoyl)ethyl]guanidine |
|---|---|
| PubChem CID | 119120935 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-[2-(propan-2-ylsulfamoyl)ethyl]guanidine |
| SMILES | Cc1cc(C)cc(N/C(N)=N/CCS(=O)(=O)NC(C)C)c1 |
| InChI | InChI=1S/C14H24N4O2S/c1-10(2)18-21(19,20)6-5-16-14(15)17-13-8-11(3)7-12(4)9-13/h7-10,18H,5-6H2,1-4H3,(H3,15,16,17) |
| InChIKey | GZEFTEJGQCSAEE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|