C14H23IN4O — CID 119117585
2-[[amino-(3,5-dimethylanilino)methylidene]amino]-N-propan-2-ylacetamide;hydroiodide (PubChem CID 119117585) has the molecular formula C14H23IN4O and a molecular weight of 390.27 g/mol. Its IUPAC name is 2-[[amino-(3,5-dimethylanilino)methylidene]amino]-N-propan-2-ylacetamide;hydroiodide.
| Compound Name | 2-[[amino-(3,5-dimethylanilino)methylidene]amino]-N-propan-2-ylacetamide;hydroiodide |
|---|---|
| PubChem CID | 119117585 |
| Molecular Formula | C14H23IN4O |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 2-[[amino-(3,5-dimethylanilino)methylidene]amino]-N-propan-2-ylacetamide;hydroiodide |
| SMILES | Cc1cc(C)cc(N/C(N)=N/CC(=O)NC(C)C)c1.I |
| InChI | InChI=1S/C14H22N4O.HI/c1-9(2)17-13(19)8-16-14(15)18-12-6-10(3)5-11(4)7-12;/h5-7,9H,8H2,1-4H3,(H,17,19)(H3,15,16,18);1H |
| InChIKey | BRKOUHKWXHLDRV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|