C12H18N2O — CID 4054179
1-(3,5-dimethylphenyl)-3-propan-2-ylurea (PubChem CID 4054179) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-propan-2-ylurea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 4054179 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-propan-2-ylurea |
| SMILES | Cc1cc(C)cc(NC(=O)NC(C)C)c1 |
| InChI | InChI=1S/C12H18N2O/c1-8(2)13-12(15)14-11-6-9(3)5-10(4)7-11/h5-8H,1-4H3,(H2,13,14,15) |
| InChIKey | CISRMVBYLJIVTC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |