C12H16N2O4 — CID 61191039
(2S)-2-[(3,5-dimethylphenyl)carbamoylamino]-3-hydroxypropanoic acid (PubChem CID 61191039) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is (2S)-2-[(3,5-dimethylphenyl)carbamoylamino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[(3,5-dimethylphenyl)carbamoylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 61191039 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | (2S)-2-[(3,5-dimethylphenyl)carbamoylamino]-3-hydroxypropanoic acid |
| SMILES | Cc1cc(C)cc(NC(=O)N[C@@H](CO)C(=O)O)c1 |
| InChI | InChI=1S/C12H16N2O4/c1-7-3-8(2)5-9(4-7)13-12(18)14-10(6-15)11(16)17/h3-5,10,15H,6H2,1-2H3,(H,16,17)(H2,13,14,18)/t10-/m0/s1 |
| InChIKey | XAOSFCVTCBOGSC-JTQLQIEISA-N |
| XLogP | 0.87 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |