C11H13FN2O4 — CID 62813429
(2S)-2-[(4-fluoro-3-methylphenyl)carbamoylamino]-3-hydroxypropanoic acid (PubChem CID 62813429) has the molecular formula C11H13FN2O4 and a molecular weight of 256.23 g/mol. Its IUPAC name is (2S)-2-[(4-fluoro-3-methylphenyl)carbamoylamino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[(4-fluoro-3-methylphenyl)carbamoylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 62813429 |
| Molecular Formula | C11H13FN2O4 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (2S)-2-[(4-fluoro-3-methylphenyl)carbamoylamino]-3-hydroxypropanoic acid |
| SMILES | Cc1cc(NC(=O)N[C@@H](CO)C(=O)O)ccc1F |
| InChI | InChI=1S/C11H13FN2O4/c1-6-4-7(2-3-8(6)12)13-11(18)14-9(5-15)10(16)17/h2-4,9,15H,5H2,1H3,(H,16,17)(H2,13,14,18)/t9-/m0/s1 |
| InChIKey | ZZENZMCXGMSGNA-VIFPVBQESA-N |
| XLogP | 0.70 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |