C18H21N3O2 — CID 51159202
N-(3,5-dimethylphenyl)-2-(phenylcarbamoylamino)propanamide (PubChem CID 51159202) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-(phenylcarbamoylamino)propanamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-(phenylcarbamoylamino)propanamide |
|---|---|
| PubChem CID | 51159202 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-(phenylcarbamoylamino)propanamide |
| SMILES | Cc1cc(C)cc(NC(=O)C(C)NC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C18H21N3O2/c1-12-9-13(2)11-16(10-12)20-17(22)14(3)19-18(23)21-15-7-5-4-6-8-15/h4-11,14H,1-3H3,(H,20,22)(H2,19,21,23) |
| InChIKey | QETVUTXHPFSBKV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |