C12H16IN5O — CID 120973958
2-[[amino-(3-methylanilino)methylidene]amino]-N-(cyanomethyl)acetamide;hydroiodide (PubChem CID 120973958) has the molecular formula C12H16IN5O and a molecular weight of 373.20 g/mol. Its IUPAC name is 2-[[amino-(3-methylanilino)methylidene]amino]-N-(cyanomethyl)acetamide;hydroiodide.
| Compound Name | 2-[[amino-(3-methylanilino)methylidene]amino]-N-(cyanomethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 120973958 |
| Molecular Formula | C12H16IN5O |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 2-[[amino-(3-methylanilino)methylidene]amino]-N-(cyanomethyl)acetamide;hydroiodide |
| SMILES | Cc1cccc(N/C(N)=N/CC(=O)NCC#N)c1.I |
| InChI | InChI=1S/C12H15N5O.HI/c1-9-3-2-4-10(7-9)17-12(14)16-8-11(18)15-6-5-13;/h2-4,7H,6,8H2,1H3,(H,15,18)(H3,14,16,17);1H |
| InChIKey | XHRJMLQUZGXXIJ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|