C19H21IN4O — CID 111073728
2-[[amino-(3,4-dimethylanilino)methylidene]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide (PubChem CID 111073728) has the molecular formula C19H21IN4O and a molecular weight of 448.31 g/mol. Its IUPAC name is 2-[[amino-(3,4-dimethylanilino)methylidene]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide.
| Compound Name | 2-[[amino-(3,4-dimethylanilino)methylidene]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111073728 |
| Molecular Formula | C19H21IN4O |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 2-[[amino-(3,4-dimethylanilino)methylidene]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide |
| SMILES | C#Cc1cccc(NC(=O)C/N=C(\N)Nc2ccc(C)c(C)c2)c1.I |
| InChI | InChI=1S/C19H20N4O.HI/c1-4-15-6-5-7-16(11-15)22-18(24)12-21-19(20)23-17-9-8-13(2)14(3)10-17;/h1,5-11H,12H2,2-3H3,(H,22,24)(H3,20,21,23);1H |
| InChIKey | NKNSEIMURKRAKK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|