C11H13IN4O — CID 75480302
2-(diaminomethylideneamino)-N-(3-ethynylphenyl)acetamide;hydroiodide (PubChem CID 75480302) has the molecular formula C11H13IN4O and a molecular weight of 344.16 g/mol. Its IUPAC name is 2-(diaminomethylideneamino)-N-(3-ethynylphenyl)acetamide;hydroiodide.
| Compound Name | 2-(diaminomethylideneamino)-N-(3-ethynylphenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 75480302 |
| Molecular Formula | C11H13IN4O |
| Molecular Weight | 344.16 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 2-(diaminomethylideneamino)-N-(3-ethynylphenyl)acetamide;hydroiodide |
| SMILES | C#Cc1cccc(NC(=O)CN=C(N)N)c1.I |
| InChI | InChI=1S/C11H12N4O.HI/c1-2-8-4-3-5-9(6-8)15-10(16)7-14-11(12)13;/h1,3-6H,7H2,(H,15,16)(H4,12,13,14);1H |
| InChIKey | NIJFEVXVEPBKBG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.16 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|