C21H23ClIN5O — CID 111073778
2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide (PubChem CID 111073778) has the molecular formula C21H23ClIN5O and a molecular weight of 523.81 g/mol. Its IUPAC name is 2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide.
| Compound Name | 2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111073778 |
| Molecular Formula | C21H23ClIN5O |
| Molecular Weight | 523.81 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | 2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide |
| SMILES | C#Cc1cccc(NC(=O)C/N=C(\N)N2CCN(c3ccc(Cl)cc3)CC2)c1.I |
| InChI | InChI=1S/C21H22ClN5O.HI/c1-2-16-4-3-5-18(14-16)25-20(28)15-24-21(23)27-12-10-26(11-13-27)19-8-6-17(22)7-9-19;/h1,3-9,14H,10-13,15H2,(H2,23,24)(H,25,28);1H |
| InChIKey | PGRPBDIYSGJDHX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.81 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|