C15H19ClN4 — CID 119147787
N'-but-3-ynyl-4-(4-chlorophenyl)piperazine-1-carboximidamide (PubChem CID 119147787) has the molecular formula C15H19ClN4 and a molecular weight of 290.80 g/mol. Its IUPAC name is N'-but-3-ynyl-4-(4-chlorophenyl)piperazine-1-carboximidamide.
| Compound Name | N'-but-3-ynyl-4-(4-chlorophenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119147787 |
| Molecular Formula | C15H19ClN4 |
| Molecular Weight | 290.80 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | N'-but-3-ynyl-4-(4-chlorophenyl)piperazine-1-carboximidamide |
| SMILES | C#CCC/N=C(\N)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C15H19ClN4/c1-2-3-8-18-15(17)20-11-9-19(10-12-20)14-6-4-13(16)5-7-14/h1,4-7H,3,8-12H2,(H2,17,18) |
| InChIKey | DOJOGOSYUHHVSC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.80 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|