C17H26ClN5S — CID 119146625
4-(4-chlorophenyl)-N'-(2-thiomorpholin-4-ylethyl)piperazine-1-carboximidamide (PubChem CID 119146625) has the molecular formula C17H26ClN5S and a molecular weight of 367.95 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-(2-thiomorpholin-4-ylethyl)piperazine-1-carboximidamide.
| Compound Name | 4-(4-chlorophenyl)-N'-(2-thiomorpholin-4-ylethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119146625 |
| Molecular Formula | C17H26ClN5S |
| Molecular Weight | 367.95 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-(2-thiomorpholin-4-ylethyl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\CCN1CCSCC1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H26ClN5S/c18-15-1-3-16(4-2-15)22-7-9-23(10-8-22)17(19)20-5-6-21-11-13-24-14-12-21/h1-4H,5-14H2,(H2,19,20) |
| InChIKey | DFTIXLJPKAVNIJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 48.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.95 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|