C17H24ClIN6 — CID 111066916
4-(4-chlorophenyl)-N'-[2-(1-methylpyrazol-4-yl)ethyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111066916) has the molecular formula C17H24ClIN6 and a molecular weight of 474.78 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[2-(1-methylpyrazol-4-yl)ethyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-chlorophenyl)-N'-[2-(1-methylpyrazol-4-yl)ethyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111066916 |
| Molecular Formula | C17H24ClIN6 |
| Molecular Weight | 474.78 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[2-(1-methylpyrazol-4-yl)ethyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | Cn1cc(CC/N=C(\N)N2CCN(c3ccc(Cl)cc3)CC2)cn1.I |
| InChI | InChI=1S/C17H23ClN6.HI/c1-22-13-14(12-21-22)6-7-20-17(19)24-10-8-23(9-11-24)16-4-2-15(18)3-5-16;/h2-5,12-13H,6-11H2,1H3,(H2,19,20);1H |
| InChIKey | RLSARJUJSWZQEL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 62.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.78 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|