C19H32ClIN6 — CID 111071067
4-(4-chlorophenyl)-N'-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111071067) has the molecular formula C19H32ClIN6 and a molecular weight of 506.86 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-chlorophenyl)-N'-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111071067 |
| Molecular Formula | C19H32ClIN6 |
| Molecular Weight | 506.86 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CN1CCCN(CC/N=C(\N)N2CCN(c3ccc(Cl)cc3)CC2)CC1.I |
| InChI | InChI=1S/C19H31ClN6.HI/c1-23-8-2-9-24(12-11-23)10-7-22-19(21)26-15-13-25(14-16-26)18-5-3-17(20)4-6-18;/h3-6H,2,7-16H2,1H3,(H2,21,22);1H |
| InChIKey | LKQIUZQXKYTTBP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 51.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.86 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|