C13H21ClIN5O2S — CID 111046626
4-(4-chlorophenyl)-N'-(2-sulfamoylethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111046626) has the molecular formula C13H21ClIN5O2S and a molecular weight of 473.77 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-(2-sulfamoylethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-chlorophenyl)-N'-(2-sulfamoylethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111046626 |
| Molecular Formula | C13H21ClIN5O2S |
| Molecular Weight | 473.77 g/mol |
| Exact Mass | 473.01 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-(2-sulfamoylethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCS(N)(=O)=O)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C13H20ClN5O2S.HI/c14-11-1-3-12(4-2-11)18-6-8-19(9-7-18)13(15)17-5-10-22(16,20)21;/h1-4H,5-10H2,(H2,15,17)(H2,16,20,21);1H |
| InChIKey | SZAWEENJTQNWRE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.77 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|