C20H25ClN4OS — CID 111807772
N'-(2-benzylsulfinylethyl)-4-(4-chlorophenyl)piperazine-1-carboximidamide (PubChem CID 111807772) has the molecular formula C20H25ClN4OS and a molecular weight of 404.97 g/mol. Its IUPAC name is N'-(2-benzylsulfinylethyl)-4-(4-chlorophenyl)piperazine-1-carboximidamide.
| Compound Name | N'-(2-benzylsulfinylethyl)-4-(4-chlorophenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111807772 |
| Molecular Formula | C20H25ClN4OS |
| Molecular Weight | 404.97 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | N'-(2-benzylsulfinylethyl)-4-(4-chlorophenyl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\CCS(=O)Cc1ccccc1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H25ClN4OS/c21-18-6-8-19(9-7-18)24-11-13-25(14-12-24)20(22)23-10-15-27(26)16-17-4-2-1-3-5-17/h1-9H,10-16H2,(H2,22,23) |
| InChIKey | YIDIAQCDBRBAJD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.97 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|