C17H28ClN5O — CID 111092906
4-(4-chlorophenyl)-N'-[2-[2-methoxyethyl(methyl)amino]ethyl]piperazine-1-carboximidamide (PubChem CID 111092906) has the molecular formula C17H28ClN5O and a molecular weight of 353.90 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[2-[2-methoxyethyl(methyl)amino]ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-chlorophenyl)-N'-[2-[2-methoxyethyl(methyl)amino]ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111092906 |
| Molecular Formula | C17H28ClN5O |
| Molecular Weight | 353.90 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[2-[2-methoxyethyl(methyl)amino]ethyl]piperazine-1-carboximidamide |
| SMILES | COCCN(C)CC/N=C(\N)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H28ClN5O/c1-21(13-14-24-2)8-7-20-17(19)23-11-9-22(10-12-23)16-5-3-15(18)4-6-16/h3-6H,7-14H2,1-2H3,(H2,19,20) |
| InChIKey | JOCXJEATOBCGBB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.90 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|