C16H24ClN5O2 — CID 111037054
2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]-N-(2-methoxyethyl)acetamide (PubChem CID 111037054) has the molecular formula C16H24ClN5O2 and a molecular weight of 353.85 g/mol. Its IUPAC name is 2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 111037054 |
| Molecular Formula | C16H24ClN5O2 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)C/N=C(\N)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H24ClN5O2/c1-24-11-6-19-15(23)12-20-16(18)22-9-7-21(8-10-22)14-4-2-13(17)3-5-14/h2-5H,6-12H2,1H3,(H2,18,20)(H,19,23) |
| InChIKey | QYQKSJMWZOBLSF-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|