C15H22ClN5O — CID 111032106
2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]-N-ethylacetamide (PubChem CID 111032106) has the molecular formula C15H22ClN5O and a molecular weight of 323.83 g/mol. Its IUPAC name is 2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]-N-ethylacetamide.
| Compound Name | 2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]-N-ethylacetamide |
|---|---|
| PubChem CID | 111032106 |
| Molecular Formula | C15H22ClN5O |
| Molecular Weight | 323.83 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]-N-ethylacetamide |
| SMILES | CCNC(=O)C/N=C(\N)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C15H22ClN5O/c1-2-18-14(22)11-19-15(17)21-9-7-20(8-10-21)13-5-3-12(16)4-6-13/h3-6H,2,7-11H2,1H3,(H2,17,19)(H,18,22) |
| InChIKey | PRVQGYQULOTMPQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.83 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|