C14H22ClIN4O — CID 111025315
4-(4-chlorophenyl)-N'-(2-hydroxypropyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111025315) has the molecular formula C14H22ClIN4O and a molecular weight of 424.71 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-(2-hydroxypropyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-chlorophenyl)-N'-(2-hydroxypropyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111025315 |
| Molecular Formula | C14H22ClIN4O |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-(2-hydroxypropyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CC(O)C/N=C(\N)N1CCN(c2ccc(Cl)cc2)CC1.I |
| InChI | InChI=1S/C14H21ClN4O.HI/c1-11(20)10-17-14(16)19-8-6-18(7-9-19)13-4-2-12(15)3-5-13;/h2-5,11,20H,6-10H2,1H3,(H2,16,17);1H |
| InChIKey | PTBLLJGDSPCPMN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|