C17H27ClIN5O — CID 111030905
N-[2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]ethyl]-2-methylpropanamide;hydroiodide (PubChem CID 111030905) has the molecular formula C17H27ClIN5O and a molecular weight of 479.79 g/mol. Its IUPAC name is N-[2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]ethyl]-2-methylpropanamide;hydroiodide.
| Compound Name | N-[2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]ethyl]-2-methylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111030905 |
| Molecular Formula | C17H27ClIN5O |
| Molecular Weight | 479.79 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | N-[2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]ethyl]-2-methylpropanamide;hydroiodide |
| SMILES | CC(C)C(=O)NCC/N=C(\N)N1CCN(c2ccc(Cl)cc2)CC1.I |
| InChI | InChI=1S/C17H26ClN5O.HI/c1-13(2)16(24)20-7-8-21-17(19)23-11-9-22(10-12-23)15-5-3-14(18)4-6-15;/h3-6,13H,7-12H2,1-2H3,(H2,19,21)(H,20,24);1H |
| InChIKey | YYRIXNPMPJHBAY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.79 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|