C20H24ClFIN5O — CID 111075700
N-[2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]ethyl]-2-fluorobenzamide;hydroiodide (PubChem CID 111075700) has the molecular formula C20H24ClFIN5O and a molecular weight of 531.80 g/mol. Its IUPAC name is N-[2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]ethyl]-2-fluorobenzamide;hydroiodide.
| Compound Name | N-[2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]ethyl]-2-fluorobenzamide;hydroiodide |
|---|---|
| PubChem CID | 111075700 |
| Molecular Formula | C20H24ClFIN5O |
| Molecular Weight | 531.80 g/mol |
| Exact Mass | 531.07 |
| IUPAC Name | N-[2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]ethyl]-2-fluorobenzamide;hydroiodide |
| SMILES | I.N/C(=N\CCNC(=O)c1ccccc1F)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H23ClFN5O.HI/c21-15-5-7-16(8-6-15)26-11-13-27(14-12-26)20(23)25-10-9-24-19(28)17-3-1-2-4-18(17)22;/h1-8H,9-14H2,(H2,23,25)(H,24,28);1H |
| InChIKey | LYYUTLPYMWUYHO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.80 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|