C18H23ClIN7O — CID 119118104
N-[2-[[amino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]ethyl]-2-chlorobenzamide;hydroiodide (PubChem CID 119118104) has the molecular formula C18H23ClIN7O and a molecular weight of 515.79 g/mol. Its IUPAC name is N-[2-[[amino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]ethyl]-2-chlorobenzamide;hydroiodide.
| Compound Name | N-[2-[[amino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]ethyl]-2-chlorobenzamide;hydroiodide |
|---|---|
| PubChem CID | 119118104 |
| Molecular Formula | C18H23ClIN7O |
| Molecular Weight | 515.79 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | N-[2-[[amino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]ethyl]-2-chlorobenzamide;hydroiodide |
| SMILES | I.N/C(=N\CCNC(=O)c1ccccc1Cl)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H22ClN7O.HI/c19-15-5-2-1-4-14(15)16(27)21-8-9-22-17(20)25-10-12-26(13-11-25)18-23-6-3-7-24-18;/h1-7H,8-13H2,(H2,20,22)(H,21,27);1H |
| InChIKey | RCNQLJAFYSUZEJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.79 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|