C10H14ClIN4O — CID 110918726
2-chloro-N-[2-(diaminomethylideneamino)ethyl]benzamide;hydroiodide (PubChem CID 110918726) has the molecular formula C10H14ClIN4O and a molecular weight of 368.61 g/mol. Its IUPAC name is 2-chloro-N-[2-(diaminomethylideneamino)ethyl]benzamide;hydroiodide.
| Compound Name | 2-chloro-N-[2-(diaminomethylideneamino)ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 110918726 |
| Molecular Formula | C10H14ClIN4O |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 2-chloro-N-[2-(diaminomethylideneamino)ethyl]benzamide;hydroiodide |
| SMILES | I.NC(N)=NCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C10H13ClN4O.HI/c11-8-4-2-1-3-7(8)9(16)14-5-6-15-10(12)13;/h1-4H,5-6H2,(H,14,16)(H4,12,13,15);1H |
| InChIKey | PXXYDLQRKLFKCJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|