C16H19ClN4OS — CID 111043298
2-chloro-N-[2-[[N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111043298) has the molecular formula C16H19ClN4OS and a molecular weight of 350.88 g/mol. Its IUPAC name is 2-chloro-N-[2-[[N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111043298 |
| Molecular Formula | C16H19ClN4OS |
| Molecular Weight | 350.88 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-chloro-N-[2-[[N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]benzamide |
| SMILES | N/C(=N\CCc1cccs1)NCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C16H19ClN4OS/c17-14-6-2-1-5-13(14)15(22)19-9-10-21-16(18)20-8-7-12-4-3-11-23-12/h1-6,11H,7-10H2,(H,19,22)(H3,18,20,21) |
| InChIKey | NXJCYUOOMFWAGJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.88 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|