C11H18IN3O2S — CID 111063902
methyl 3-[[N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]propanoate;hydroiodide (PubChem CID 111063902) has the molecular formula C11H18IN3O2S and a molecular weight of 383.26 g/mol. Its IUPAC name is methyl 3-[[N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]propanoate;hydroiodide.
| Compound Name | methyl 3-[[N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111063902 |
| Molecular Formula | C11H18IN3O2S |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | methyl 3-[[N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]propanoate;hydroiodide |
| SMILES | COC(=O)CCN/C(N)=N/CCc1cccs1.I |
| InChI | InChI=1S/C11H17N3O2S.HI/c1-16-10(15)5-7-14-11(12)13-6-4-9-3-2-8-17-9;/h2-3,8H,4-7H2,1H3,(H3,12,13,14);1H |
| InChIKey | WZQZYYNRKUPHRY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|