C17H21BrN4OS — CID 111094233
N-(5-bromo-2-methylphenyl)-3-[[N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]propanamide (PubChem CID 111094233) has the molecular formula C17H21BrN4OS and a molecular weight of 409.35 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-3-[[N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]propanamide.
| Compound Name | N-(5-bromo-2-methylphenyl)-3-[[N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111094233 |
| Molecular Formula | C17H21BrN4OS |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-3-[[N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]propanamide |
| SMILES | Cc1ccc(Br)cc1NC(=O)CCN/C(N)=N/CCc1cccs1 |
| InChI | InChI=1S/C17H21BrN4OS/c1-12-4-5-13(18)11-15(12)22-16(23)7-9-21-17(19)20-8-6-14-3-2-10-24-14/h2-5,10-11H,6-9H2,1H3,(H,22,23)(H3,19,20,21) |
| InChIKey | QDAVTGIAILPQEF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|