C16H23BrN4O — CID 111094253
N-(5-bromo-2-methylphenyl)-3-[[N'-(cyclobutylmethyl)carbamimidoyl]amino]propanamide (PubChem CID 111094253) has the molecular formula C16H23BrN4O and a molecular weight of 367.29 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-3-[[N'-(cyclobutylmethyl)carbamimidoyl]amino]propanamide.
| Compound Name | N-(5-bromo-2-methylphenyl)-3-[[N'-(cyclobutylmethyl)carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111094253 |
| Molecular Formula | C16H23BrN4O |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-3-[[N'-(cyclobutylmethyl)carbamimidoyl]amino]propanamide |
| SMILES | Cc1ccc(Br)cc1NC(=O)CCN/C(N)=N/CC1CCC1 |
| InChI | InChI=1S/C16H23BrN4O/c1-11-5-6-13(17)9-14(11)21-15(22)7-8-19-16(18)20-10-12-3-2-4-12/h5-6,9,12H,2-4,7-8,10H2,1H3,(H,21,22)(H3,18,19,20) |
| InChIKey | BJCLYOBCVFXGAS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|