C18H24BrIN4OS — CID 111894004
N-(5-bromo-2-methylphenyl)-3-[[N'-methyl-N-[(3-methylthiophen-2-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111894004) has the molecular formula C18H24BrIN4OS and a molecular weight of 551.29 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-3-[[N'-methyl-N-[(3-methylthiophen-2-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(5-bromo-2-methylphenyl)-3-[[N'-methyl-N-[(3-methylthiophen-2-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111894004 |
| Molecular Formula | C18H24BrIN4OS |
| Molecular Weight | 551.29 g/mol |
| Exact Mass | 549.99 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-3-[[N'-methyl-N-[(3-methylthiophen-2-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(/NCCC(=O)Nc1cc(Br)ccc1C)NCc1sccc1C.I |
| InChI | InChI=1S/C18H23BrN4OS.HI/c1-12-4-5-14(19)10-15(12)23-17(24)6-8-21-18(20-3)22-11-16-13(2)7-9-25-16;/h4-5,7,9-10H,6,8,11H2,1-3H3,(H,23,24)(H2,20,21,22);1H |
| InChIKey | ZZZSSRDBRJWDOZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.29 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|