C20H24BrFN4O — CID 111361627
N-(5-bromo-2-methylphenyl)-3-[[N-[2-(2-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]propanamide (PubChem CID 111361627) has the molecular formula C20H24BrFN4O and a molecular weight of 435.34 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-3-[[N-[2-(2-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]propanamide.
| Compound Name | N-(5-bromo-2-methylphenyl)-3-[[N-[2-(2-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111361627 |
| Molecular Formula | C20H24BrFN4O |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-3-[[N-[2-(2-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]propanamide |
| SMILES | C/N=C(/NCCC(=O)Nc1cc(Br)ccc1C)NCCc1ccccc1F |
| InChI | InChI=1S/C20H24BrFN4O/c1-14-7-8-16(21)13-18(14)26-19(27)10-12-25-20(23-2)24-11-9-15-5-3-4-6-17(15)22/h3-8,13H,9-12H2,1-2H3,(H,26,27)(H2,23,24,25) |
| InChIKey | COKCWIIJCLCHKE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|