C18H20ClFN2O — CID 109024857
N-(5-chloro-2-methylphenyl)-3-[2-(2-fluorophenyl)ethylamino]propanamide (PubChem CID 109024857) has the molecular formula C18H20ClFN2O and a molecular weight of 334.82 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-3-[2-(2-fluorophenyl)ethylamino]propanamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-3-[2-(2-fluorophenyl)ethylamino]propanamide |
|---|---|
| PubChem CID | 109024857 |
| Molecular Formula | C18H20ClFN2O |
| Molecular Weight | 334.82 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-3-[2-(2-fluorophenyl)ethylamino]propanamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)CCNCCc1ccccc1F |
| InChI | InChI=1S/C18H20ClFN2O/c1-13-6-7-15(19)12-17(13)22-18(23)9-11-21-10-8-14-4-2-3-5-16(14)20/h2-7,12,21H,8-11H2,1H3,(H,22,23) |
| InChIKey | OSEQMCNKBMZANH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.82 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|