C20H23ClFN3O — CID 113108965
N-(5-chloro-2-methylphenyl)-4-[2-(2-fluorophenyl)ethyl]piperazine-1-carboxamide (PubChem CID 113108965) has the molecular formula C20H23ClFN3O and a molecular weight of 375.88 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-4-[2-(2-fluorophenyl)ethyl]piperazine-1-carboxamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-4-[2-(2-fluorophenyl)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113108965 |
| Molecular Formula | C20H23ClFN3O |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-4-[2-(2-fluorophenyl)ethyl]piperazine-1-carboxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)N1CCN(CCc2ccccc2F)CC1 |
| InChI | InChI=1S/C20H23ClFN3O/c1-15-6-7-17(21)14-19(15)23-20(26)25-12-10-24(11-13-25)9-8-16-4-2-3-5-18(16)22/h2-7,14H,8-13H2,1H3,(H,23,26) |
| InChIKey | CCWIFDMGJCDEJG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |