C18H18ClFN2O2 — CID 108948290
N'-(5-chloro-2-methylphenyl)-N-[2-(2-fluorophenyl)ethyl]propanediamide (PubChem CID 108948290) has the molecular formula C18H18ClFN2O2 and a molecular weight of 348.81 g/mol. Its IUPAC name is N'-(5-chloro-2-methylphenyl)-N-[2-(2-fluorophenyl)ethyl]propanediamide.
| Compound Name | N'-(5-chloro-2-methylphenyl)-N-[2-(2-fluorophenyl)ethyl]propanediamide |
|---|---|
| PubChem CID | 108948290 |
| Molecular Formula | C18H18ClFN2O2 |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N'-(5-chloro-2-methylphenyl)-N-[2-(2-fluorophenyl)ethyl]propanediamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)CC(=O)NCCc1ccccc1F |
| InChI | InChI=1S/C18H18ClFN2O2/c1-12-6-7-14(19)10-16(12)22-18(24)11-17(23)21-9-8-13-4-2-3-5-15(13)20/h2-7,10H,8-9,11H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | OBJBQWLJNKCZRZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|