C18H19Cl2FN2O — CID 109000291
2-[2-(2,4-dichlorophenyl)ethylamino]-N-[2-(2-fluorophenyl)ethyl]acetamide (PubChem CID 109000291) has the molecular formula C18H19Cl2FN2O and a molecular weight of 369.27 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenyl)ethylamino]-N-[2-(2-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-[2-(2,4-dichlorophenyl)ethylamino]-N-[2-(2-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 109000291 |
| Molecular Formula | C18H19Cl2FN2O |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2-[2-(2,4-dichlorophenyl)ethylamino]-N-[2-(2-fluorophenyl)ethyl]acetamide |
| SMILES | O=C(CNCCc1ccc(Cl)cc1Cl)NCCc1ccccc1F |
| InChI | InChI=1S/C18H19Cl2FN2O/c19-15-6-5-13(16(20)11-15)7-9-22-12-18(24)23-10-8-14-3-1-2-4-17(14)21/h1-6,11,22H,7-10,12H2,(H,23,24) |
| InChIKey | JNQHGUNRPSJIBJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|