C16H14Cl2F2N2O — CID 109007030
N-[2-(2,4-dichlorophenyl)ethyl]-2-(2,6-difluoroanilino)acetamide (PubChem CID 109007030) has the molecular formula C16H14Cl2F2N2O and a molecular weight of 359.20 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2-(2,6-difluoroanilino)acetamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-(2,6-difluoroanilino)acetamide |
|---|---|
| PubChem CID | 109007030 |
| Molecular Formula | C16H14Cl2F2N2O |
| Molecular Weight | 359.20 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-(2,6-difluoroanilino)acetamide |
| SMILES | O=C(CNc1c(F)cccc1F)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H14Cl2F2N2O/c17-11-5-4-10(12(18)8-11)6-7-21-15(23)9-22-16-13(19)2-1-3-14(16)20/h1-5,8,22H,6-7,9H2,(H,21,23) |
| InChIKey | LVYREQPOXZMMNT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.20 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |