C17H13Cl2F2NO3 — CID 2515179
[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2,6-difluorobenzoate (PubChem CID 2515179) has the molecular formula C17H13Cl2F2NO3 and a molecular weight of 388.20 g/mol. Its IUPAC name is [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2,6-difluorobenzoate.
| Compound Name | [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2,6-difluorobenzoate |
|---|---|
| PubChem CID | 2515179 |
| Molecular Formula | C17H13Cl2F2NO3 |
| Molecular Weight | 388.20 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2,6-difluorobenzoate |
| SMILES | O=C(COC(=O)c1c(F)cccc1F)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H13Cl2F2NO3/c18-11-5-4-10(12(19)8-11)6-7-22-15(23)9-25-17(24)16-13(20)2-1-3-14(16)21/h1-5,8H,6-7,9H2,(H,22,23) |
| InChIKey | KUWAIHHPARWDNA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.20 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |