C17H14ClF2NO3 — CID 8625292
[2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl] 5-chloro-2-fluorobenzoate (PubChem CID 8625292) has the molecular formula C17H14ClF2NO3 and a molecular weight of 353.75 g/mol. Its IUPAC name is [2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl] 5-chloro-2-fluorobenzoate.
| Compound Name | [2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl] 5-chloro-2-fluorobenzoate |
|---|---|
| PubChem CID | 8625292 |
| Molecular Formula | C17H14ClF2NO3 |
| Molecular Weight | 353.75 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | [2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl] 5-chloro-2-fluorobenzoate |
| SMILES | O=C(COC(=O)c1cc(Cl)ccc1F)NCCc1ccccc1F |
| InChI | InChI=1S/C17H14ClF2NO3/c18-12-5-6-15(20)13(9-12)17(23)24-10-16(22)21-8-7-11-3-1-2-4-14(11)19/h1-6,9H,7-8,10H2,(H,21,22) |
| InChIKey | YZOPLZFCAWDEPE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.75 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |