C12H13ClFNO4 — CID 8620148
[2-(2-methoxyethylamino)-2-oxoethyl] 5-chloro-2-fluorobenzoate (PubChem CID 8620148) has the molecular formula C12H13ClFNO4 and a molecular weight of 289.69 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 5-chloro-2-fluorobenzoate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 5-chloro-2-fluorobenzoate |
|---|---|
| PubChem CID | 8620148 |
| Molecular Formula | C12H13ClFNO4 |
| Molecular Weight | 289.69 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 5-chloro-2-fluorobenzoate |
| SMILES | COCCNC(=O)COC(=O)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C12H13ClFNO4/c1-18-5-4-15-11(16)7-19-12(17)9-6-8(13)2-3-10(9)14/h2-3,6H,4-5,7H2,1H3,(H,15,16) |
| InChIKey | SLHVMRMXUGHFEA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.69 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|