C14H17BrFNO3 — CID 55401451
[2-oxo-2-(pentylamino)ethyl] 5-bromo-2-fluorobenzoate (PubChem CID 55401451) has the molecular formula C14H17BrFNO3 and a molecular weight of 346.20 g/mol. Its IUPAC name is [2-oxo-2-(pentylamino)ethyl] 5-bromo-2-fluorobenzoate.
| Compound Name | [2-oxo-2-(pentylamino)ethyl] 5-bromo-2-fluorobenzoate |
|---|---|
| PubChem CID | 55401451 |
| Molecular Formula | C14H17BrFNO3 |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | [2-oxo-2-(pentylamino)ethyl] 5-bromo-2-fluorobenzoate |
| SMILES | CCCCCNC(=O)COC(=O)c1cc(Br)ccc1F |
| InChI | InChI=1S/C14H17BrFNO3/c1-2-3-4-7-17-13(18)9-20-14(19)11-8-10(15)5-6-12(11)16/h5-6,8H,2-4,7,9H2,1H3,(H,17,18) |
| InChIKey | KLKLQEOKMLPNNS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|