About [2-(diethylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate
[2-(diethylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate (PubChem CID 55338812) has the molecular formula C13H15BrFNO3
and a molecular weight of 332.17 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate.
Molecular Properties
| Compound Name | [2-(diethylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate |
| PubChem CID | 55338812 |
| Molecular Formula | C13H15BrFNO3 |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate |
| SMILES | CCN(CC)C(=O)COC(=O)c1cc(Br)ccc1F |
| InChI | InChI=1S/C13H15BrFNO3/c1-3-16(4-2)12(17)8-19-13(18)10-7-9(14)5-6-11(10)15/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | IVEQWNADUHBWQI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(diethylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(diethylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate?
The IUPAC name of [2-(diethylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate (CID 55338812) is [2-(diethylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate.
What is the SMILES notation for [2-(diethylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate?
The canonical SMILES for [2-(diethylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate is CCN(CC)C(=O)COC(=O)c1cc(Br)ccc1F.
What is the InChIKey of [2-(diethylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate?
The InChIKey is IVEQWNADUHBWQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrFNO3/c1-3-16(4-2)12(17)8-19-13(18)10-7-9(14)5-6-11(10)15/h5-7H,3-4,8H2,1-2H3.
What are the key properties of [2-(diethylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate?
[2-(diethylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate has a molecular weight of 332.17 g/mol, XLogP of 2.61, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(diethylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate is sourced from PubChem (CID 55338812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).