C15H17BrClNO3 — CID 55315118
[2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 5-bromo-2-chlorobenzoate (PubChem CID 55315118) has the molecular formula C15H17BrClNO3 and a molecular weight of 374.66 g/mol. Its IUPAC name is [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 5-bromo-2-chlorobenzoate.
| Compound Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 5-bromo-2-chlorobenzoate |
|---|---|
| PubChem CID | 55315118 |
| Molecular Formula | C15H17BrClNO3 |
| Molecular Weight | 374.66 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 5-bromo-2-chlorobenzoate |
| SMILES | C=C(C)CN(CC)C(=O)COC(=O)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C15H17BrClNO3/c1-4-18(8-10(2)3)14(19)9-21-15(20)12-7-11(16)5-6-13(12)17/h5-7H,2,4,8-9H2,1,3H3 |
| InChIKey | DIJPARCILHYDRM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.66 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|