C19H27NO5 — CID 55316186
[2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 3,4-diethoxybenzoate (PubChem CID 55316186) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 3,4-diethoxybenzoate.
| Compound Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 55316186 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 3,4-diethoxybenzoate |
| SMILES | C=C(C)CN(CC)C(=O)COC(=O)c1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C19H27NO5/c1-6-20(12-14(4)5)18(21)13-25-19(22)15-9-10-16(23-7-2)17(11-15)24-8-3/h9-11H,4,6-8,12-13H2,1-3,5H3 |
| InChIKey | FENNSQHBPXOCJM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|