C23H29NO5 — CID 55326340
[2-[benzyl(ethyl)amino]-2-oxoethyl] 3-ethoxy-4-propoxybenzoate (PubChem CID 55326340) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is [2-[benzyl(ethyl)amino]-2-oxoethyl] 3-ethoxy-4-propoxybenzoate.
| Compound Name | [2-[benzyl(ethyl)amino]-2-oxoethyl] 3-ethoxy-4-propoxybenzoate |
|---|---|
| PubChem CID | 55326340 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | [2-[benzyl(ethyl)amino]-2-oxoethyl] 3-ethoxy-4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)OCC(=O)N(CC)Cc2ccccc2)cc1OCC |
| InChI | InChI=1S/C23H29NO5/c1-4-14-28-20-13-12-19(15-21(20)27-6-3)23(26)29-17-22(25)24(5-2)16-18-10-8-7-9-11-18/h7-13,15H,4-6,14,16-17H2,1-3H3 |
| InChIKey | NRHLRPAGFBCJLG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |