C18H26N2O6 — CID 8885400
[2-[[2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl] 3-ethoxy-4-propoxybenzoate (PubChem CID 8885400) has the molecular formula C18H26N2O6 and a molecular weight of 366.41 g/mol. Its IUPAC name is [2-[[2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl] 3-ethoxy-4-propoxybenzoate.
| Compound Name | [2-[[2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl] 3-ethoxy-4-propoxybenzoate |
|---|---|
| PubChem CID | 8885400 |
| Molecular Formula | C18H26N2O6 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | [2-[[2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl] 3-ethoxy-4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)OCC(=O)NCC(=O)N(C)C)cc1OCC |
| InChI | InChI=1S/C18H26N2O6/c1-5-9-25-14-8-7-13(10-15(14)24-6-2)18(23)26-12-16(21)19-11-17(22)20(3)4/h7-8,10H,5-6,9,11-12H2,1-4H3,(H,19,21) |
| InChIKey | YEZSDLGDXWVZHH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |