C21H24FNO5 — CID 2646544
[2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 3-ethoxy-4-propoxybenzoate (PubChem CID 2646544) has the molecular formula C21H24FNO5 and a molecular weight of 389.42 g/mol. Its IUPAC name is [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 3-ethoxy-4-propoxybenzoate.
| Compound Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 3-ethoxy-4-propoxybenzoate |
|---|---|
| PubChem CID | 2646544 |
| Molecular Formula | C21H24FNO5 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 3-ethoxy-4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)OCC(=O)NCc2ccc(F)cc2)cc1OCC |
| InChI | InChI=1S/C21H24FNO5/c1-3-11-27-18-10-7-16(12-19(18)26-4-2)21(25)28-14-20(24)23-13-15-5-8-17(22)9-6-15/h5-10,12H,3-4,11,13-14H2,1-2H3,(H,23,24) |
| InChIKey | YNWPOXGSBXOYQQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |