C23H28FNO5 — CID 29201029
[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3-ethoxy-4-(2-methylpropoxy)benzoate (PubChem CID 29201029) has the molecular formula C23H28FNO5 and a molecular weight of 417.48 g/mol. Its IUPAC name is [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3-ethoxy-4-(2-methylpropoxy)benzoate.
| Compound Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3-ethoxy-4-(2-methylpropoxy)benzoate |
|---|---|
| PubChem CID | 29201029 |
| Molecular Formula | C23H28FNO5 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3-ethoxy-4-(2-methylpropoxy)benzoate |
| SMILES | CCOc1cc(C(=O)OCC(=O)NCCc2ccc(F)cc2)ccc1OCC(C)C |
| InChI | InChI=1S/C23H28FNO5/c1-4-28-21-13-18(7-10-20(21)29-14-16(2)3)23(27)30-15-22(26)25-12-11-17-5-8-19(24)9-6-17/h5-10,13,16H,4,11-12,14-15H2,1-3H3,(H,25,26) |
| InChIKey | JOWQKHAALNYBBD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |